A4761912
5-Hydroxynicotinic Acid Methyl Ester , 98% , 30766-22-4
Synonym(s):
5-Hydroxy nicotinic acid methyl ester;Methyl 5-hydroxynicotinate
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB142.40 | In Stock |
|
| 25G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190 °C |
| Boiling point: | 374.2±22.0 °C(Predicted) |
| Density | 1.287±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Heated, Sonicated), Methanol (Slightly, Sonicated) |
| pka | 8.44±0.10(Predicted) |
| form | Powder and Lumps |
| color | Light beige |
| InChI | InChI=1S/C7H7NO3/c1-11-7(10)5-2-6(9)4-8-3-5/h2-4,9H,1H3 |
| InChIKey | KJJSHOHQQHACLE-UHFFFAOYSA-N |
| SMILES | C1=NC=C(O)C=C1C(OC)=O |
Description and Uses
Methyl 5-Hydroxynicotinate is an intermediate used to prepare selective cyclooxygenase-2 inhibitors. It is also used to prepare imino sugars as inhibitors of liver glycogen phosphorylase.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-37/38 |
| Safety Statements | 26-36/37/39-39-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 29333990 |
