A4760712
2-Hydroxy-3-methylpyridine , >98.0%(GC) , 1003-56-1
CAS NO.：1003-56-1
Empirical Formula: C6H7NO
Molecular Weight: 109.13
MDL number: MFCD00039704
EINECS: 213-710-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB286.40 | In Stock |
|
| 100g | RMB1004.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-141 °C |
| Boiling point: | 204.59°C (rough estimate) |
| Density | 1.1143 (rough estimate) |
| refractive index | 1.5444 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | 12.61±0.10(Predicted) |
| color | White to Orange to Green |
| BRN | 1422044 |
| InChI | InChI=1S/C6H7NO/c1-5-3-2-4-7-6(5)8/h2-4H,1H3,(H,7,8) |
| InChIKey | MVKDNXIKAWKCCS-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC=C1C |
| CAS DataBase Reference | 1003-56-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2(1H)-pyridinone, 3-methyl-(1003-56-1) |
Description and Uses
3-Methyl-2-pyridone, is used as a reactant with chloro-methoxy-methane to produce 1-methoxymethyl-3-methyl-1H-pyridin-2-one. This reaction will need reagent solvent CH2Cl2. The reaction time is 24 hours with ambient temperature
Safety
| Symbol(GHS) |    GHS06,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H319-H302-H315-H318-H335 |
| Precautionary statements | P280a-P301+P310a-P405-P501a-P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-41-37/38-22 |
| Safety Statements | 36/37/39-26-22-36 |
| WGK Germany | 3 |
| HS Code | 29333995 |
