A4610612
GDP Disodium Salt , 90% , 7415-69-2
Synonym(s):
5′-GDP-Na2
CAS NO.：7415-69-2
Empirical Formula: C10H16N5NaO11P2
Molecular Weight: 467.2
MDL number: MFCD00066538
EINECS: 231-026-2
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB79.20 | In Stock |
|
| 500MG | RMB159.20 | In Stock |
|
| 1g | RMB255.20 | In Stock |
|
| 5g | RMB799.20 | In Stock |
|
| 25g | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >280°C (dec.) |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Powder |
| color | White |
| Water Solubility | Soluble in water |
| Stability: | Hygroscopic |
| InChIKey | PVMPTWQLNDHIEV-NGPBCCOENA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(NC(N)=NC1=2)=O)O.[NaH] |&1:1,2,3,15,r| |
Description and Uses
Guanosine-5'-diphosphate disodium salt is used to study the kinetics and characteristics of GTPases such as those associated with G-protein coupled receptors. It is also used to study cell signaling processes mediate by guanine nucleotide exchange factors.
Safety
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29349990 |
