A4397612
4'-Fluoropropiophenone , >97.0%(GC) , 456-03-1
CAS NO.：456-03-1
Empirical Formula: C9H9FO
Molecular Weight: 152.17
MDL number: MFCD00000356
EINECS: 207-255-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB206.40 | In Stock |
|
| 500g | RMB1034.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100-102 °C (22 mmHg) |
| Density | 1.096 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 170 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.096 |
| color | Colorless to Light orange to Yellow |
| BRN | 1210310 |
| InChI | InChI=1S/C9H9FO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | QIJNVLLXIIPXQT-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(F)C=C1)(=O)CC |
Description and Uses
4′-Fluoropropiophenone was used in the preparation of 2-(4-fluorophenyl)-3-methylquinoxaline.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H227-H319-H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P210e-P280a-P405-P501a-P210-P264-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38 |
| Safety Statements | 26-39-37/39 |
| RIDADR | 2735 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HS Code | 29147000 |
