A4369512
2-(4-Fluorophenyl)ethylamine , ≥98% , 1583-88-6
CAS NO.：1583-88-6
Empirical Formula: C8H10FN
Molecular Weight: 139.17
MDL number: MFCD00134208
EINECS: 216-435-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB73.60 | In Stock |
|
| 25G | RMB255.20 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 50-52 °C/0.15 mmHg (lit.) |
| Density | 1.061 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 174 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 9.84±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.061 |
| color | Yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H10FN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2 |
| InChIKey | CKLFJWXRWIQYOC-UHFFFAOYSA-N |
| SMILES | C1(CCN)=CC=C(F)C=C1 |
| CAS DataBase Reference | 1583-88-6(CAS DataBase Reference) |
Description and Uses
4-Fluorophenethylamine may be employed as nucleophile in the synthesis of 2-amino-4-arylpyrimidine derivatives. It is suitable for use in the preparation of ortho-metalated primary phenethylamines having electron-releasing and electron-withdrawing groups on the aromatic ring, leading to complexes containing six membered palladacycles.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H227-H300-H310-H318-H330-H301-H311-H314-H331 |
| Precautionary statements | P261-P280-P305+P351+P338-P310-P301+P310a-P303+P361+P353-P304+P340-P320-P405-P501a |
| Hazard Codes | T,C |
| Risk Statements | 23/24/25-34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 2922 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29214200 |
