A4346312
2-Fluoro-6-(trifluoromethyl)aniline , 98% , 144851-61-6
Synonym(s):
α,α,α,6-Tetrafluoro-o-toluidine;2-Amino-3-fluorobenzotrifluoride
CAS NO.：144851-61-6
Empirical Formula: C7H5F4N
Molecular Weight: 179.11
MDL number: MFCD00061242
EINECS: 626-647-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB92.00 | In Stock |
|
| 5G | RMB391.20 | In Stock |
|
| 10g | RMB719.20 | In Stock |
|
| 25g | RMB1647.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 155 °C(lit.) |
| Density | 1.388 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 128 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 0.07±0.10(Predicted) |
| form | liquid |
| color | Clear, colourless |
| InChI | InChI=1S/C7H5F4N/c8-5-3-1-2-4(6(5)12)7(9,10)11/h1-3H,12H2 |
| InChIKey | CQSFHEFEKDRLKE-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C(F)(F)F)C=CC=C1F |
| CAS DataBase Reference | 144851-61-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Amino-3-fluorobenzotrifluoride(144851-61-6) |
Description and Uses
2-Fluoro-6-(trifluoromethyl)aniline may be used in the preparation of bis[4-amino-3-fluoro-5-(trifluoromethyl)phenyl]methane.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,F,Xi |
| Risk Statements | 10-20/21/22-36/37/38 |
| Safety Statements | 16-26-27-36/37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Harmful/Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2921420090 |
