A4330512
2-Fluoro-4-nitrobenzoic acid , 98% , 403-24-7
CAS NO.：403-24-7
Empirical Formula: C7H4FNO4
Molecular Weight: 185.11
MDL number: MFCD00275565
EINECS: 609-823-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB50.40 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB214.40 | In Stock |
|
| 100G | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170 °C |
| Boiling point: | 352.5±27.0 °C(Predicted) |
| Density | 1.568±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.37±0.13(Predicted) |
| color | White to Light yellow |
| BRN | 2582091 |
| InChI | InChI=1S/C7H4FNO4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | MMWFMFZFCKADEL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C=C1F |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39-36/37/39-22 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
