A4311812
3-Fluoro-4-nitrobenzoic Acid , 98% , 403-21-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB197.60 | In Stock |
|
| 100G | RMB719.20 | In Stock |
|
| 500g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-175°C |
| Boiling point: | 372.8±27.0 °C(Predicted) |
| Density | 1.568±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.08±0.10(Predicted) |
| color | White to Light yellow to Green |
| InChI | InChI=1S/C7H4FNO4/c8-5-3-4(7(10)11)1-2-6(5)9(12)13/h1-3H,(H,10,11) |
| InChIKey | WVZBIQSKLXJFNX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C(F)=C1 |
Description and Uses
3-Fluoro-4-nitrobenzoic Acid is used in the synthesis of ABT-072, a non-nucleoside HCV NS5B polymerase inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-37/38-36-22 |
| Safety Statements | 26-36/37/39-37 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
