A4314712
Fmoc-Trp(Boc)-OH , 97% , 143824-78-6
Synonym(s):
Nα-Fmoc-N(in)-Boc-L -tryptophan;N(in)-Boc-Nα-Fmoc-L -tryptophan;Fmoc-Trp(Boc)-OH;N-α-Fmoc-N-in-t.-Boc-L-tryptophan
CAS NO.：143824-78-6
Empirical Formula: C31H30N2O6
Molecular Weight: 526.58
MDL number: MFCD00153366
EINECS: 604-383-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB398.40 | In Stock |
|
| 100G | RMB1302.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ca 97℃ |
| alpha | -21 º (c=1%, DMF) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| refractive index | -20 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solid |
| pka | 3.71±0.10(Predicted) |
| color | White to Orange to Green |
| optical activity | [α]20/D 21±2°, c = 1% in DMF |
| Sensitive | Moisture Sensitive |
| BRN | 7698009 |
| InChIKey | ADOHASQZJSJZBT-SANMLTNESA-N |
| SMILES | C(O)(=O)[C@H](CC1C2=C(C=CC=C2)N(C(OC(C)(C)C)=O)C=1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
Description and Uses
Fmoc-Trp(Boc)-OH can be used for the synthesis of analogs of glucagon-like peptide-1 (GLP-1) for the treatment of type 2 diabetes and various peptides by Fmoc solid phase peptide synthesis (SPPS).
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H401-H411 |
| Precautionary statements | P261-P280g-P302+P352a-P321-P333+P313-P501a |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-51/53-43 |
| Safety Statements | 22-24/25-36/37/39-27-26-61-37-24 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 9 |
| HS Code | 29339900 |
