A4127112
edoxaban tosylate hydrate , 97% , 1229194-11-9
CAS NO.：1229194-11-9
Empirical Formula: C31H38ClN7O7S2
Molecular Weight: 720.26
MDL number: MFCD28400751
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB55.20 | In Stock |
|
| 10MG | RMB95.20 | In Stock |
|
| 25mg | RMB159.20 | In Stock |
|
| 100mg | RMB447.20 | In Stock |
|
| 250mg | RMB1007.20 | In Stock |
|
| 1G | RMB3536.00 | In Stock |
|
| 5g | RMB12375.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >252°C (dec.) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | Chloroform (Very Slightly), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChIKey | ZLFZITWZOYXXAW-BUZWFPPCNA-N |
| SMILES | S(C1C=CC(C)=CC=1)(O)(=O)=O.N([C@@H]1C[C@@H](C(=O)N(C)C)CC[C@@H]1NC(=O)C(=O)NC1N=CC(Cl)=CC=1)C(C1SC2CN(C)CCC=2N=1)=O |&1:12,14,22,r| |
Description and Uses
Edoxaban is an anticoagulant drug which acts as a direct factor Xa inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
