A4056712
Ethyl 2-Aminobenzothiazole-6-carboxylate , >98.0% , 50850-93-6
CAS NO.：50850-93-6
Empirical Formula: C10H10N2O2S
Molecular Weight: 222.26
MDL number: MFCD00102724
EINECS: 672-388-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB87.20 | In Stock |
|
| 25g | RMB319.20 | In Stock |
|
| 100g | RMB1100.80 | In Stock |
|
| 500g | RMB4239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 241-243°C |
| Boiling point: | 386.8±34.0 °C(Predicted) |
| Density | 1.364±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 2.79±0.10(Predicted) |
| form | Solid |
| color | White to Orange to Green |
| InChI | InChI=1S/C10H10N2O2S/c1-2-14-9(13)6-3-4-7-8(5-6)15-10(11)12-7/h3-5H,2H2,1H3,(H2,11,12) |
| InChIKey | VYJSGJXWKSDUSG-UHFFFAOYSA-N |
| SMILES | S1C2=CC(C(OCC)=O)=CC=C2N=C1N |
| CAS DataBase Reference | 50850-93-6(CAS DataBase Reference) |
Description and Uses
Ethyl 2-amino-benzothiazole-6-carboxylate (cas# 50850-93-6) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2934208090 |
