A4033512
Ethyl 4-acetylbutyrate , ≥98% , 13984-57-1
Synonym(s):
4-Acetylbutyric acid ethyl ester;5-Oxohexanoic acid ethyl ester;Ethyl 5-oxohexanoate
CAS NO.：13984-57-1
Empirical Formula: C8H14O3
Molecular Weight: 158.2
MDL number: MFCD00009213
EINECS: 237-776-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB191.20 | In Stock |
|
| 25G | RMB640.00 | In Stock |
|
| 100G | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 221-222 °C(lit.) |
| Density | 0.989 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 157 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| BRN | 1762625 |
| InChI | InChI=1S/C8H14O3/c1-3-11-8(10)6-4-5-7(2)9/h3-6H2,1-2H3 |
| InChIKey | MGPSIDGTLFKDEY-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCC(=O)C |
| EPA Substance Registry System | Ethyl 5-oxohexanoate (13984-57-1) |
Description and Uses
Ethyl 4-acetylbutyrate is used to prepare tyrosine-derived RGD peptidomimetics containing oligoethylene glycol (OEG) spacers. It is also used to synthesize constrained glycyl amides derived from RGD tripeptide as nonpeptide αvβ3 antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2918300090 |
