A4022312
1-Ethylcyclopentanol , ≥96.0%(GC) , 1462-96-0
CAS NO.：1462-96-0
Empirical Formula: C7H14O
Molecular Weight: 114.19
MDL number: MFCD00019281
EINECS: 622-831-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 25G | RMB503.20 | In Stock |
|
| 100g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -10°C(lit.) |
| Boiling point: | 153°C(lit.) |
| Density | 0.909 g/mL at 25 °C |
| Flash point: | 49°(120°F) |
| refractive index | 1.4570 |
| storage temp. | 2-8°C |
| form | Liquid |
| pka | 15.38±0.20(Predicted) |
| color | Colorless to yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C7H14O/c1-2-7(8)5-3-4-6-7/h8H,2-6H2,1H3 |
| InChIKey | LPCWIFPJLFCXRS-UHFFFAOYSA-N |
| SMILES | C1(CC)(O)CCCC1 |
| CAS DataBase Reference | 1462-96-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Cyclopentanol, 1-ethyl-(1462-96-0) |
Description and Uses
1-Ethylcyclopentanol is a cyclic alcohol used in the production of cyclopentanol derivatives. These derivatives serve as intermediates for agrochemicals, pharmaceuticals, and flavors.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302-H319 |
| Precautionary statements | P210-P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 10-22-36 |
| Safety Statements | 26 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | 3 |
| HS Code | 2906.19.5000 |
| HazardClass | 3 |
| PackingGroup | III |
