A4006212
Edoxaban , ≥98% , 480449-70-5
CAS NO.：480449-70-5
Empirical Formula: C24H30ClN7O4S
Molecular Weight: 548.06
MDL number: MFCD13195544
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB660.00 | In Stock |
|
| 10MG | RMB1359.20 | In Stock |
|
| 50MG | RMB4479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >213°C (dec.) |
| Density | 1.43 |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| pka | 9.46±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChIKey | HGVDHZBSSITLCT-JLJPHGGASA-N |
| SMILES | C(NC1=NC=C(Cl)C=C1)(=O)C(N[C@H]1CC[C@H](C(N(C)C)=O)C[C@H]1NC(C1=NC2CCN(C)CC=2S1)=O)=O |
| LogP | -1.455 |
Description and Uses
oral factor Xa inhibitor
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H373 |
| Precautionary statements | P260-P314-P501 |
| Hazardous Substances Data | 480449-70-5(Hazardous Substances Data) |
