A3998312
Ethyl 5-Chloroindole-2-carboxylate , 98% , 4792-67-0
CAS NO.：4792-67-0
Empirical Formula: C11H10ClNO2
Molecular Weight: 223.66
MDL number: MFCD00005610
EINECS: 225-345-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB247.20 | In Stock |
|
| 100G | RMB791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166-168 °C (lit.) |
| Boiling point: | 375.0±22.0 °C(Predicted) |
| Density | 1.2405 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.10±0.30(Predicted) |
| form | Powder or Crystals |
| color | Yellow to orange to tan or light brown |
| BRN | 170255 |
| InChI | InChI=1S/C11H10ClNO2/c1-2-15-11(14)10-6-7-5-8(12)3-4-9(7)13-10/h3-6,13H,2H2,1H3 |
| InChIKey | LWKIFKYHCJAIAB-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C=C1C(OCC)=O |
| CAS DataBase Reference | 4792-67-0(CAS DataBase Reference) |
Description and Uses
Ethyl 5-chloro-2-indolecarboxylate was used in the synthesis of anti-allergic agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
