A5038412
Ethyl Indole-2-carboxylate , 97% , 3770-50-1
Synonym(s):
2-Ethoxycarbonylindole;NSC 10076
CAS NO.：3770-50-1
Empirical Formula: C11H11NO2
Molecular Weight: 189.21
MDL number: MFCD00005609
EINECS: 223-206-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB83.20 | In Stock |
|
| 100g | RMB289.60 | In Stock |
|
| 250g | RMB668.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-125 °C (lit.) |
| Boiling point: | 324.47°C (rough estimate) |
| Density | 1.1596 (rough estimate) |
| refractive index | 1.5012 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 15.01±0.30(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White to yellow |
| BRN | 146395 |
| InChI | InChI=1S/C11H11NO2/c1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h3-7,12H,2H2,1H3 |
| InChIKey | QQXQAEWRSVZPJM-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C=C1C(OCC)=O |
Description and Uses
2-Ethoxycarbonylindole is a building block that has been used as a reactant for the preparation of pyridazinoindole derivatives that have antimicrobial activities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29339990 |
