A3785612
2,3-Dichlorobenzotrifluoride , 98% , 54773-19-2
CAS NO.：54773-19-2
Empirical Formula: C7H3Cl2F3
Molecular Weight: 215
MDL number: MFCD00069115
EINECS: 259-336-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25g | RMB99.20 | In Stock |
|
| 100g | RMB299.20 | In Stock |
|
| 500g | RMB1109.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -26 C |
| Boiling point: | 177-179 C |
| Density | 1,483 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, colourless |
| InChI | InChI=1S/C7H3Cl2F3/c8-5-3-1-2-4(6(5)9)7(10,11)12/h1-3H |
| InChIKey | BJYHBJUWZMHGGQ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(C(F)(F)F)=C1Cl |
Description and Uses
2,3-Dichlorobenzotrifluoride can be used as an intermediate in the synthesis of darifenacin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H320-H335 |
| Precautionary statements | P264-P270-P301+P312-P330 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| HazardClass | IRRITANT |
| HS Code | 2903998090 |
