A3465012
4-(Dimethylamino)benzonitrile , 98% , 1197-19-9
Synonym(s):
4-Cyano-N,N-dimethylaniline;DMABN
CAS NO.：1197-19-9
Empirical Formula: C9H10N2
Molecular Weight: 146.19
MDL number: MFCD00001815
EINECS: 214-819-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5G | RMB143.20 | In Stock |
|
| 25G | RMB471.20 | In Stock |
|
| 100G | RMB1511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-75 °C(lit.) |
| Boiling point: | 318 °C(lit.) |
| Density | 1.3346 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| Flash point: | 317-319°C |
| solubility | soluble in Methanol |
| pka | 1.61±0.12(Predicted) |
| form | Crystalline Powder |
| color | Light brown |
| BRN | 971606 |
| InChI | InChI=1S/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| InChIKey | JYMNQRQQBJIMCV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N(C)C)C=C1 |
| CAS DataBase Reference | 1197-19-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzonitrile, 4-(dimethylamino)- (1197-19-9) |
Description and Uses
4-(Dimethylamino)benzonitrile can be used in the synthesis of 3,6-diphenyl-2,5-dihydro-pyrrolo[3,4-c]pyrrole-1,4-dione derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36/37-36 |
| RIDADR | 3276 |
| WGK Germany | 2 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
