A3424812
2,6-Diamino-3,5-difluoropyridine , ≥98.0% , 247069-27-8
CAS NO.：247069-27-8
Empirical Formula: C5H5F2N3
Molecular Weight: 145.11
MDL number: MFCD03412208
EINECS: 623-869-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB75.20 | In Stock |
|
| 5G | RMB314.40 | In Stock |
|
| 25g | RMB1307.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160°C |
| Boiling point: | 233.3±35.0 °C(Predicted) |
| Density | 1.517±0.06 g/cm3(Predicted) |
| pka | 1.93±0.10(Predicted) |
| InChI | InChI=1S/C5H5F2N3/c6-2-1-3(7)5(9)10-4(2)8/h1H,(H4,8,9,10) |
| InChIKey | GCIUCMRUMOAHKR-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(N)=C(F)C=C1F |
Description and Uses
3,5-Difluoropyridine-2,6-diamine is a reagent used for the synthesis of 1-(6-amino-3,5-difluoropyridin-2-yl)fluoroquinolone which is possessed antimycobacterial and antibacterial activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 21/22-36/37-36 |
| Safety Statements | 24-26-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| HS Code | 29333990 |
