A3401912
Dimethyl methylmalonate , 99% , 609-02-9
CAS NO.：609-02-9
Empirical Formula: C6H10O4
Molecular Weight: 146.14
MDL number: MFCD00075185
EINECS: 210-173-6
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB40.80 | In Stock |
|
| 5ML | RMB151.20 | In Stock |
|
| 25ML | RMB607.20 | In Stock |
|
| 100ml | RMB1526.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 176-177 °C(lit.) |
| Density | 1.098 g/mL at 25 °C(lit.) |
| vapor pressure | 0.2 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 169 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.08±0.46(Predicted) |
| form | liquid |
| color | Colourless |
| Specific Gravity | approximate 1.10 (20℃) |
| InChI | InChI=1S/C6H10O4/c1-4(5(7)9-2)6(8)10-3/h4H,1-3H3 |
| InChIKey | LRBPFPZTIZSOGG-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(C)C(OC)=O |
| CAS DataBase Reference | 609-02-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanedioic acid, methyl-, dimethyl ester(609-02-9) |
| EPA Substance Registry System | Propanedioic acid, methyl-, dimethyl ester (609-02-9) |
Description and Uses
Dimethyl methylmalonate is a versatile compound with multiple uses in the chemical industry. It is a key ingredient in the synthesis of flavours and other organic compounds.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS02 |
| Signal word | Danger |
| Hazard statements | H335-H336-H304-H401-H225 |
| Precautionary statements | P501-P261-P273-P240-P210-P233-P243-P241-P242-P271-P280-P370+P378-P331-P303+P361+P353-P301+P310-P304+P340+P312-P403+P233-P403+P235-P405 |
| WGK Germany | 3 |
| HS Code | 2917198090 |
