A3374812
3，3’-Dinitrobenzidine , ≥95.0%(HPLC) , 6271-79-0
CAS NO.：6271-79-0
Empirical Formula: C12H10N4O4
Molecular Weight: 274.23
MDL number: MFCD00024264
EINECS: 228-457-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB319.20 | In Stock |
|
| 5G | RMB1119.20 | In Stock |
|
| 25G | RMB1436.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 275°C |
| Boiling point: | 497.4±45.0 °C(Predicted) |
| Density | 1.498±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Acetone, DMSO |
| form | Solid |
| pka | -0.54±0.10(Predicted) |
| color | Red |
| InChI | InChI=1S/C12H10N4O4/c13-9-3-1-7(5-11(9)15(17)18)8-2-4-10(14)12(6-8)16(19)20/h1-6H,13-14H2 |
| InChIKey | OCEINMLGYDSKFW-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(N)C([N+]([O-])=O)=C2)=CC=C(N)C([N+]([O-])=O)=C1 |
Description and Uses
3,3'-Dinitrobenzidine is used for preparation of symmetrical bis-benzimidazole derivatives for inhibition of gastric acid secretion.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-36/37/39 |
| RTECS | DD1250000 |
| HS Code | 2921.59.8090 |
