A3266812
2,6-Dibromo-4-(trifluoromethoxy)aniline , 98% , 88149-49-9
CAS NO.：88149-49-9
Empirical Formula: C7H4Br2F3NO
Molecular Weight: 334.92
MDL number: MFCD00153113
EINECS: 201-805-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB72.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-74 °C(lit.) |
| Boiling point: | 65/0.1mm |
| Density | 2.036±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -0.38±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C7H4Br2F3NO/c8-4-1-3(14-7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 |
| InChIKey | JBSWOEGXMADXOU-UHFFFAOYSA-N |
| SMILES | C1(N)=C(Br)C=C(OC(F)(F)F)C=C1Br |
Description and Uses
2,6-Dibromo-4-(trifluoromethoxy)benzenamine is used in the synthesis of novel pyridylpyrazole acid derivatives in the preparation of agricultural insecticides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-60-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29222990 |
