A3262512
2,4-Difluorobenzaldehyde , 98% , 1550-35-2
CAS NO.：1550-35-2
Empirical Formula: C7H4F2O
Molecular Weight: 142.1
MDL number: MFCD00010326
EINECS: 216-287-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB104.80 | In Stock |
|
| 100G | RMB340.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 2-3 °C (lit.) |
| Boiling point: | 65-66 °C/17 mmHg (lit.) |
| Density | 1.299 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 131 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid |
| Specific Gravity | 1.299 |
| color | Clear colorless |
| Sensitive | Air Sensitive |
| BRN | 2243422 |
| InChI | InChI=1S/C7H4F2O/c8-6-2-1-5(4-10)7(9)3-6/h1-4H |
| InChIKey | WCGPCBACLBHDCI-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(F)C=C1F |
Description and Uses
2,4-Difluorobenzaldehyde was used in the synthesis of 3-benzylidene 20,29-dihydrobetulinic acid derivatives.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36-37/39-16-36/37 |
| RIDADR | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| F | 10-23 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29130000 |
