A3245912
2,4-Dichloro-5-fluoropyrimidine , 98% , 2927-71-1
CAS NO.：2927-71-1
Empirical Formula: C4HCl2FN2
Molecular Weight: 166.97
MDL number: MFCD00233551
EINECS: 625-810-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB572.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-41 °C (lit.) |
| Boiling point: | 80 °C / 16mmHg |
| Density | 1.605±0.06 g/cm3(Predicted) |
| Flash point: | 223 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Chloroform, Methanol |
| pka | -3.96±0.29(Predicted) |
| form | Powder or Crystalline Powder or Low Melting Solid |
| color | White to pale brown |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C4HCl2FN2/c5-3-2(7)1-8-4(6)9-3/h1H |
| InChIKey | WHPFEQUEHBULBW-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(F)C(Cl)=N1 |
Description and Uses
2,4-Dichloro-5-fluoropyrimidine is used in the synthesis of two glucuronic derivatives of 5-fluorouracil as neoplasm inhibitors. It is used in the synthesis of two glucuronic derivatives of 5-fluorouracil as neoplasm inhibitors.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34-22 |
| Safety Statements | 26-36-37/39-45-36/37/39 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29335990 |
