A3159212
3,4-Dimethylbenzophenone , 99% , 2571-39-3
CAS NO.：2571-39-3
Empirical Formula: C15H14O
Molecular Weight: 210.27
MDL number: MFCD00008525
EINECS: 219-916-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB25.60 | In Stock |
|
| 100G | RMB96.80 | In Stock |
|
| 500G | RMB417.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-47 °C (lit.) |
| Boiling point: | 335°C |
| Density | 1.0232 (rough estimate) |
| refractive index | 1.5361 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 1952043 |
| InChI | InChI=1S/C15H14O/c1-11-8-9-14(10-12(11)2)15(16)13-6-4-3-5-7-13/h3-10H,1-2H3 |
| InChIKey | JENOLWCGNVWTJN-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C(C)=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 2571-39-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Dimethylbenzophenone(2571-39-3) |
Description and Uses
3,4-Dimethylbenzophenone is an important chemical material for organic synthesis or laboratory research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25-22-36 |
| WGK Germany | 3 |
| HS Code | 29143990 |
