A3109112
2,6-Dibromopyridine , 98% , 626-05-1
CAS NO.：626-05-1
Empirical Formula: C5H3Br2N
Molecular Weight: 236.89
MDL number: MFCD00006223
EINECS: 210-926-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 100G | RMB223.20 | In Stock |
|
| 250g | RMB415.20 | In Stock |
|
| 500G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C (lit.) |
| Boiling point: | 255°C |
| Density | 2.0383 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| Flash point: | 213 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -3.65±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to gray or buff |
| Water Solubility | insoluble |
| BRN | 108922 |
| InChI | InChI=1S/C5H3Br2N/c6-4-2-1-3-5(7)8-4/h1-3H |
| InChIKey | FEYDZHNIIMENOB-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(Br)=CC=C1 |
Description and Uses
2,6-Dibromopyridine is used as a tridentate chelating ligand and in the formation of macrocycles containing the terpyridine moiety. It is also used to produce 6-bromo-2-methoxypyridine.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H312+H332-H315-H319-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xi,T,T+ |
| Risk Statements | 36/37/38-25-20/21-52-28-52/53-36/38 |
| Safety Statements | 26-37/39-45-36/37/39-36-36/37-28-61 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | US7883000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29333999 |
