A2848812
2-Chloro-6-fluoropyridine , 98% , 20885-12-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB136.80 | In Stock |
|
| 100g | RMB402.40 | In Stock |
|
| 500g | RMB3679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31.0 to 35.0 °C |
| Boiling point: | 169.2±20.0 °C(Predicted) |
| Density | 1.331±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | -2.45±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C5H3ClFN/c6-4-2-1-3-5(7)8-4/h1-3H |
| InChIKey | LXOHKRGLGLETIJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(F)=CC=C1 |
| CAS DataBase Reference | 20885-12-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi,F,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36-39 |
| Hazard Note | Flammable/Irritant |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
