A2633012
2-Chloro-1,3,2-dioxaphospholane , >97.0%(GC) , 822-39-9
Synonym(s):
Cyclic ethylene chlorophosphite;Cyclic ethylene phosphorochloridite;Ethylene chlorophosphite;Ethylene glycol chlorophosphite
CAS NO.：822-39-9
Empirical Formula: C2H4ClO2P
Molecular Weight: 126.48
MDL number: MFCD00014511
EINECS: 212-499-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.80 | In Stock |
|
| 5G | RMB143.20 | In Stock |
|
| 25G | RMB471.20 | In Stock |
|
| 100g | RMB1791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -28°C(lit.) |
| Boiling point: | 62 °C/20 mmHg (lit.) |
| Density | 1.422 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 158 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 506179 |
| Stability: | Extremely Moisture Sensitive |
| CAS DataBase Reference | 822-39-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethylene chlorophosphite(822-39-9) |
| EPA Substance Registry System | 1,3,2-Dioxaphospholane, 2-chloro- (822-39-9) |
Description and Uses
Highly reactive cyclic phosphitylating reagent which provides fast coupling rates, and hydrolytic cleavage occurs more readily than with acyclic analogs
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 14-34-37 |
| Safety Statements | 26-36/37/39-45-8-25 |
| RIDADR | UN 3264 8/PG 2 |
| WGK Germany | 3 |
| F | 1-10 |
| Hazard Note | Highly reactive cyclic phosphitylating reagent which |
| TSCA | Yes |
| HS Code | 2934.99.9001 |
| HazardClass | 8 |
| PackingGroup | II |
