A2624312
2-Chloro-1-propene , >97.0%(GC) , 557-98-2
Synonym(s):
2-Chloro-1-propene;Isopropenyl chloride
CAS NO.：557-98-2
Empirical Formula: C3H5Cl
Molecular Weight: 76.52
MDL number: MFCD00000859
EINECS: 209-187-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -138 °C |
| Boiling point: | 23 °C |
| Density | 0.91 |
| refractive index | n |
| Flash point: | -20°C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1361376 |
| InChI | InChI=1S/C3H5Cl/c1-3(2)4/h1H2,2H3 |
| InChIKey | PNLQPWWBHXMFCA-UHFFFAOYSA-N |
| SMILES | C=C(Cl)C |
| CAS DataBase Reference | 557-98-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloropropene (557-98-2) |
Description and Uses
2-Chloropropene is used in measurement of photoionization cross sections of allyl and 2-propenyl radicals to form C3H5+ by tunable vacuum ultraviolet synchrotron radiation coupled with photofragment translational spectroscopy.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H224-H319-H335 |
| Precautionary statements | P210-P305+P351+P338-P403+P233 |
| Hazard Codes | F+,Xi |
| Risk Statements | 12-36/37 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 2456 3/PG 1 |
| WGK Germany | 3 |
| RTECS | UC7200000 |
| F | 10-23 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | I |
| HS Code | 2903290000 |
| Hazardous Substances Data | 557-98-2(Hazardous Substances Data) |
