A2546112
4-Chloro-6,7-dimethoxyquinoline , ≥98.0% , 35654-56-9
CAS NO.：35654-56-9
Empirical Formula: C11H10ClNO2
Molecular Weight: 223.66
MDL number: MFCD07778437
EINECS: 676-028-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB87.20 | In Stock |
|
| 25G | RMB308.00 | In Stock |
|
| 100g | RMB1160.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132.0 to 136.0 °C |
| Boiling point: | 325.2±37.0 °C(Predicted) |
| Density | 1.265±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.95±0.30(Predicted) |
| color | Pale Brown to Light Brown |
| InChI | InChI=1S/C11H10ClNO2/c1-14-10-5-7-8(12)3-4-13-9(7)6-11(10)15-2/h3-6H,1-2H3 |
| InChIKey | WRVHQEYBCDPZEU-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(OC)=C(OC)C=2)C(Cl)=CC=1 |
Description and Uses
4-Chloro-6,7-dimethoxyquinoline, can be used as an intermediate for the synthesis of various pharmaceutical and biologically active compounds. It is used for the preparation of Tivozanib (T447205), and Cabozantinib (C051500), acting as anticancer agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45-24/25 |
| RIDADR | UN2811 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
