A2438512
Clobetasol propionate , ≥98.0% , 25122-46-7
Synonym(s):
Clobetasol propionate
CAS NO.：25122-46-7
Empirical Formula: C25H32ClFO5
Molecular Weight: 466.97
MDL number: MFCD00058499
EINECS: 246-634-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB97.60 | In Stock |
|
| 5G | RMB378.40 | In Stock |
|
| 25g | RMB1339.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195.5-1970C |
| alpha | D +103.8° (c = 1.04 in dioxane) |
| Boiling point: | 569.0±50.0 °C(Predicted) |
| Density | 1.1653 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Practically insoluble in water, freely soluble in acetone, sparingly soluble in ethanol (96 per cent). |
| pka | 12.88±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| InChIKey | CBGUOGMQLZIXBE-XGQKBEPLSA-N |
| SMILES | O([C@@]1([C@H](C[C@@]2([H])[C@]3([H])CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C)C)C(=O)CCl)C(=O)CC |&1:1,2,4,6,16,18,20,23,r| |
| CAS DataBase Reference | 25122-46-7(CAS DataBase Reference) |
Description and Uses
Clobetasol-17-propionate is a topical corticosteroid belonging to the group-D (hydrocortisone-q-butyrate) type of steroids.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H360Df-H373-H413 |
| Precautionary statements | P201-P273-P308+P313 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-62-53-48/20/21-61 |
| Safety Statements | 26-36-45-36/37-53 |
| WGK Germany | 2 |
| RTECS | TU3725000 |
| HS Code | 29372290 |
