A2432612
1-Chloro-3,5-dibromobenzene , 98% , 14862-52-3
CAS NO.：14862-52-3
Empirical Formula: C6H3Br2Cl
Molecular Weight: 270.35
MDL number: MFCD00070765
EINECS: 627-184-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB133.60 | In Stock |
|
| 100G | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-94 °C (lit.) |
| Boiling point: | 256 °C |
| Density | 2.021±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C6H3Br2Cl/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | FNKCOUREFBNNHG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(Cl)=CC(Br)=C1 |
Description and Uses
1,3-Dibromo-5-chlorobenzene is a reactant in the preparation of orally bioavailable 1-(1H-indol-4-yl)-3,5-disubstituted benzene analogs as antimitotic agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29039990 |
