PRODUCT Properties
| Melting point: | 113-115 °C (lit.) |
| Boiling point: | 288.02°C (rough estimate) |
| Density | 1.2799 (rough estimate) |
| refractive index | 1.5230 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| form | powder to crystal |
| pka | 3.13±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 1876444 |
| InChI | InChI=1S/C9H9ClO3/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-6H,1H3,(H,11,12) |
| InChIKey | YNTJKQDWYXUTLZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(OC1=CC=CC(Cl)=C1)C |
Description and Uses
2-(3-Chlorophenoxy)propionic acid
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | UE9285000 |
| HS Code | 29163990 |
| Toxicity | LD50 oral in rat: > 750mg/kg |
