A1542612
Bis(4-nitrophenyl) Sulfide , >99.0%(HPLC) , 1223-31-0
CAS NO.：1223-31-0
Empirical Formula: C12H8N2O4S
Molecular Weight: 276.27
MDL number: MFCD00039745
EINECS: 214-950-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB257.60 | In Stock |
|
| 25G | RMB711.20 | In Stock |
|
| 100g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160°C |
| Boiling point: | 487.4±30.0 °C(Predicted) |
| Density | 1.4634 (rough estimate) |
| refractive index | 1.6930 (estimate) |
| solubility | soluble in Acetone |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | InChI=1S/C12H8N2O4S/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H |
| InChIKey | ZZTJMQPRKBNGNX-UHFFFAOYSA-N |
| SMILES | S(C1=CC=C([N+]([O-])=O)C=C1)C1=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 1223-31-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1,1'-thiobis[4-nitro- (1223-31-0) |
Description and Uses
Used as organic synthesis intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2811 |
| RTECS | WQ2150000 |
| HS Code | 2930.90.2900 |
| Toxicity | rat,LD50,oral,1490mg/kg (1490mg/kg),"Prehled Prumyslove Toxikologie; Organicke Latky," Marhold, J., Prague, Czechoslovakia, Avicenum, 1986Vol. -, Pg. 1005, 1986. |
