A1513212
1,3-Benzenedisulfonyl Chloride , 96% , 585-47-7
CAS NO.：585-47-7
Empirical Formula: C6H4Cl2O4S2
Molecular Weight: 275.13
MDL number: MFCD00041879
EINECS: 209-556-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB92.00 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 25G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-60 °C(lit.) |
| Boiling point: | 145 °C / 1mmHg |
| Density | 1.6494 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Dichloromethane, DMSO |
| form | solid |
| color | Off-White to Light Brown |
| Water Solubility | Soluble in DMSO and methanol. Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 1118508 |
| InChI | InChI=1S/C6H4Cl2O4S2/c7-13(9,10)5-2-1-3-6(4-5)14(8,11)12/h1-4H |
| InChIKey | ALIQZUMMPOYCIS-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=CC(S(Cl)(=O)=O)=C1 |
| CAS DataBase Reference | 585-47-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Benzenedisulfonyl dichloride (585-47-7) |
Description and Uses
1,3-Benzenedisulfonyl chloride is used as a pharmaceutical intermediates. The compound is used to produce1,3-benzenedisulfonohydrazide.
Safety
| Symbol(GHS) |   GHS08,GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H318-H314-H317-H334 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P501a-P261-P280-P305+P351+P338-P310-P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | 34-37-42/43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 3-21 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
