A1459512
1-Benzhydryl-3-azetidinyl methanesulfonate , 95% , 33301-41-6
CAS NO.：33301-41-6
Empirical Formula: C17H19NO3S
Molecular Weight: 317.4
MDL number: MFCD00159216
EINECS: 608-857-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB30.40 | In Stock |
|
| 5g | RMB63.20 | In Stock |
|
| 25g | RMB249.60 | In Stock |
|
| 100g | RMB773.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-112°C |
| Boiling point: | 459.9±34.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Dichloromethane, Ether, Ethyl Acetate, Methanol |
| form | Solid |
| pka | 5.67±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C17H19NO3S/c1-22(19,20)21-16-12-18(13-16)17(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3 |
| InChIKey | MSVZMUILYMLJCF-UHFFFAOYSA-N |
| SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(OS(C)(=O)=O)C1 |
Description and Uses
A proline analog and proline formation inhibitor
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
