A1457112
4-Bromo-2-chloroaniline , 98% , 38762-41-3
CAS NO.：38762-41-3
Empirical Formula: C6H5BrClN
Molecular Weight: 206.47
MDL number: MFCD00007660
EINECS: 254-118-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB37.60 | In Stock |
|
| 25G | RMB92.00 | In Stock |
|
| 50G | RMB143.20 | In Stock |
|
| 100G | RMB216.80 | In Stock |
|
| 250G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-72 °C (lit.) |
| Boiling point: | 241.8±20.0 °C(Predicted) |
| Density | 1.6567 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 1.95±0.10(Predicted) |
| form | Crystalline Powder |
| color | Slightly yellow to light brown |
| BRN | 3117740 |
| InChI | InChI=1S/C6H5BrClN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| InChIKey | INMZDDDQLHKGPF-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C=C1Cl |
Description and Uses
4-Bromo-2-chloroaniline was used in the peparation of 3,4-dichloro-α-trichloromethylbenzyl alcohol.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302+H312+H332-H302-H311-H332 |
| Precautionary statements | P280-P280h-P302+P352-P309-P310-P261-P264-P270-P271-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-20/21 |
| Safety Statements | 36-23 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HS Code | 29214200 |
