PRODUCT Properties
| Melting point: | 273-275 °C |
| Boiling point: | 568.3±45.0 °C(Predicted) |
| Density | 1.611±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMF: 12 mg/ml; DMSO: 10 mg/ml |
| form | A solid |
| pka | 6.82±0.20(Predicted) |
| color | White to gray |
| InChI | InChI=1S/C13H10N2O5/c16-8-3-1-2-6-10(8)13(20)15(12(6)19)7-4-5-9(17)14-11(7)18/h1-3,7,16H,4-5H2,(H,14,17,18) |
| InChIKey | XMPJICVFSDYOEG-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(O)=CC=C2)C(=O)N1C1CCC(=O)NC1=O |
Description and Uses
4-Hydroxy-thalidomide is the Thalidomide-based Cereblon ligand used in the recruitment of CRBN protein. It can be connected to the ligand for protein by a linker to form PROTACs.
2-(2,6-Dioxopiperidin-3-yl)-4-hydroxyisoindoline-1,3-dione is an intermediate for the synthesis of dTAG-13 (D710020), which is a degradation tag which was tested for its efficiency at depleting FKBP12F36V -MELK(sg3R) and was found to have significantly degraded FKBP12F36V -MELK(sg3R) within 4 hours.Used in the study of cancer research.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H361 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P201-P202-P281-P308+P313-P405-P501 |
| HS Code | 2933998090 |
