A1357012
5-Bromo-2-nitropyridine , 99% , 39856-50-3
CAS NO.：39856-50-3
Empirical Formula: C5H3BrN2O2
Molecular Weight: 202.99
MDL number: MFCD00160411
EINECS: 609-748-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB72.80 | In Stock |
|
| 100G | RMB243.20 | In Stock |
|
| 500g | RMB1013.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150 °C (lit.) |
| Boiling point: | 292.3±20.0 °C(Predicted) |
| Density | 1.833±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -4.95±0.22(Predicted) |
| color | White to yellow to beige powder or crystal or chunks |
| BRN | 120878 |
| InChI | InChI=1S/C5H3BrN2O2/c6-4-1-2-5(7-3-4)8(9)10/h1-3H |
| InChIKey | ATXXLNCPVSUCNK-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=C(Br)C=C1 |
Description and Uses
5-Bromo-2-nitropyridine is employed as a reagent in the synthesis of novel benzinidazoles, potent inhibitors of TIE-2 and VEGFR-2 Tyrosine (T899975) kinase receptors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29339900 |
