A1343312
2-Bromo-3,5-dichloropyridine , 98% , 14482-51-0
CAS NO.：14482-51-0
Empirical Formula: C5H2BrCl2N
Molecular Weight: 226.89
MDL number: MFCD00233990
EINECS: 672-535-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB140.00 | In Stock |
|
| 100G | RMB458.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-42 |
| Boiling point: | 243.3±35.0 °C(Predicted) |
| Density | 1.848±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -2.37±0.10(Predicted) |
| form | Solid |
| color | Pale brown |
| InChI | InChI=1S/C5H2BrCl2N/c6-5-4(8)1-3(7)2-9-5/h1-2H |
| InChIKey | QCKPJWDIDCGQRB-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(Cl)C=C1Cl |
Description and Uses
2-Bromo-3,5-dichloropyridine is used in various fields, including pharmaceuticals, agrochemicals, and materials science. It is an essential intermediate for the synthesis of different chemical compounds, such as fungicides, herbicides, and insecticides.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-41-37/38-25 |
| Safety Statements | 26-45-39 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
