A1340512
2-Bromo-6-fluorobenzaldehyde , 96% , 360575-28-6
CAS NO.：360575-28-6
Empirical Formula: C7H4BrFO
Molecular Weight: 203.01
MDL number: MFCD03407341
EINECS: 675-097-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB207.20 | In Stock |
|
| 100g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-47 °C |
| Boiling point: | 100-102℃/8mm |
| Density | 1.70 |
| Flash point: | >110°(230°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chlorofrom (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H4BrFO/c8-6-2-1-3-7(9)5(6)4-10/h1-4H |
| InChIKey | PJNILWKRAKKEQM-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(F)C=CC=C1Br |
Description and Uses
It is a important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| HS Code | 29130000 |
