A1339312
2-Bromo-4-tert-butylphenol , 97% , 2198-66-5
CAS NO.：2198-66-5
Empirical Formula: C10H13BrO
Molecular Weight: 229.11
MDL number: MFCD02682891
EINECS: 218-602-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB114.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51°C(lit.) |
| Boiling point: | 113°C/9mmHg(lit.) |
| Density | 1.341±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 8.65±0.18(Predicted) |
| color | Clear Colourless |
| InChI | InChI=1S/C10H13BrO/c1-10(2,3)7-4-5-9(12)8(11)6-7/h4-6,12H,1-3H3 |
| InChIKey | FFRLMQPMGIMHHQ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(C)(C)C)C=C1Br |
Description and Uses
2-Bromo-4-tert-butylphenol is useful synthetic compound that can be used to prepare 2-?Mesityl-?4-?tert-?butylphenol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2908190090 |
![2,2-Bis[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]propane](https://img.chemicalbook.com/CAS/GIF/21850-44-2.gif)
