A1327012
4-Bromo-1-indanone , 97% , 15115-60-3
CAS NO.：15115-60-3
Empirical Formula: C9H7BrO
Molecular Weight: 211.06
MDL number: MFCD01719772
EINECS: 628-019-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 10G | RMB103.20 | In Stock |
|
| 25G | RMB177.60 | In Stock |
|
| 100G | RMB614.40 | In Stock |
|
| 500g | RMB3003.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-99 °C(lit.) |
| Boiling point: | 125°C/1.5mmHg(lit.) |
| Density | 1.608±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Orange-brown |
| InChI | InChI=1S/C9H7BrO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2 |
| InChIKey | UVVYFYLSZIMKMC-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(Br)=CC=C2)CC1 |
Description and Uses
4-Bromo-1-indanone is used to prepare N''-indanyl-N-benzopyrazolyl ureas as TRPV1 antagonists for use as analgesics. It is also used to synthesize 1,4-dihydroindeno[1,2-c]pyrazoles as KDR kinase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H315 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280i-P301+P312a-P337+P313-P501a-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-60-36 |
| WGK Germany | 2 |
| RTECS | NK7536100 |
| HS Code | 29147000 |
