A1299812
2-Bromo-6-methoxypyridine , 97% , 40473-07-2
CAS NO.：40473-07-2
Empirical Formula: C6H6BrNO
Molecular Weight: 188.02
MDL number: MFCD00088345
EINECS: 628-883-3
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB31.20 | In Stock |
|
| 5ML | RMB44.00 | In Stock |
|
| 25ML | RMB159.20 | In Stock |
|
| 100ML | RMB464.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 206 °C (lit.) |
| Density | 1.53 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 220 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| pka | -1.04±0.10(Predicted) |
| color | Clear colorless to golden |
| InChI | InChI=1S/C6H6BrNO/c1-9-6-4-2-3-5(7)8-6/h2-4H,1H3 |
| InChIKey | KMODISUYWZPVGV-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(OC)=CC=C1 |
Description and Uses
The commercial 2-Bromo-6-methoxypyridine could be used as a starting material to synthesize cyclopenta[b]pyridin-2,5-dione. The overall route consists of a first sequence of regioselective ortho lithiation and methoxycarbonylation followed by Heck vinylation, alkene reduction, cyclization, and decarboxylation[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
