A1190412
2-Bromo-6-methylpyridine , 98% , 5315-25-3
CAS NO.：5315-25-3
Empirical Formula: C6H6BrN
Molecular Weight: 172.02
MDL number: MFCD00040743
EINECS: 226-173-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB20.00 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 100G | RMB239.20 | In Stock |
|
| 500g | RMB1160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 102-103 °C/20 mmHg (lit.) |
| Density | 1.512 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 207 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Ethyl Aceate |
| pka | 1.51±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.512 |
| color | Clear colorless to yellow |
| Water Solubility | Soluble in chloroform, ethyl aceate. Not miscible or difficult to mix with water. |
| BRN | 107322 |
| InChI | InChI=1S/C6H6BrN/c1-5-3-2-4-6(7)8-5/h2-4H,1H3 |
| InChIKey | SOHDPICLICFSOP-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(C)=CC=C1 |
Description and Uses
2-Bromo-6-methylpyridine may be used in the synthesis of the following:
- 6,6′-dimethyl-2,2′-bipyridine
- 6-methyl-2-pyridyl-2-pyridylmethanone
- 2-methyl-6-(trimethylsilyl)-pyridine
- N,N′-bis-(6-methylpyrid-2-yl)-(1R,2R)-1,2- diaminocyclohexane (cydiampy)
- 2-methyl-6-(trimethylstannanyl)pyridine
- 2-(6-methylpyridin-2-yl)propan-2-ol
- bis[(2-bromo-6-methylpyridinium)hexafluorosilicate] monohydrate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
