A1237712
3-Bromopentane , 95% , 1809-10-5
Synonym(s):
3-Pentyl bromide
CAS NO.：1809-10-5
Empirical Formula: C5H11Br
Molecular Weight: 151.04
MDL number: MFCD00000158
EINECS: 217-314-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB53.60 | In Stock |
|
| 5G | RMB168.00 | In Stock |
|
| 25G | RMB631.20 | In Stock |
|
| 100G | RMB1732.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -126.2°C |
| Boiling point: | 118-119 °C (lit.) |
| Density | 1.216 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 65 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Miscible with ethanol, ether, benzene and chloroform. |
| form | Liquid |
| color | Clear pale yellow |
| BRN | 1730967 |
| Dielectric constant | 8.3699999999999992 |
| InChI | InChI=1S/C5H11Br/c1-3-5(6)4-2/h5H,3-4H2,1-2H3 |
| InChIKey | VTOQFOCYBTVOJZ-UHFFFAOYSA-N |
| SMILES | CCC(Br)CC |
Description and Uses
3-Bromopentane is a glass forming liquid used in the preparation of 2-(1-ethyl-propoxy)-isoindole-1,3-dione. Further, it is employed in organic synthesis.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29033990 |
