(R)-(+)-2,2′-Bis(diphenylphosphino)-1,1′-binaphthalene , 98% , 76189-55-4
Synonym(s):
(R)-(+)-(1,1′-Binaphthalene-2,2′-diyl)bis(diphenylphosphine);(R)-(+)-2,2′-Bis(diphenylphosphino)-1,1′-binaphthalene;(R)-(+)-2,2′-Bis(diphenylphosphino)-1,1′-binaphthyl;(R)-(+)-BINAP
CAS NO.：76189-55-4
Empirical Formula: C44H32P2
Molecular Weight: 622.69
MDL number: MFCD00010805
EINECS: 616-304-7
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB23.20 | In Stock |
|
| 250MG | RMB28.00 | In Stock |
|
| 1G | RMB34.40 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25g | RMB439.20 | In Stock |
|
| 100g | RMB1679.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 283-286 °C(lit.) |
| Boiling point: | 724.3±55.0 °C(Predicted) |
| alpha | 240 º (c=0.3, toluene) |
| refractive index | 235 ° (C=0.3, Toluene) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Benzene (Slightly), Chloroform (Slightly) |
| form | Powder |
| color | White to cream-white |
| optical activity | [α]20/D +222°, c = 0.5% in benzene |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| Merck | 14,1223 |
| BRN | 4914063 |
| InChIKey | MUALRAIOVNYAIW-UHFFFAOYSA-N |
| SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC2=CC=CC=C2C=1C1C2=CC=CC=C2C=CC=1P(C1C=CC=CC=1)C1C=CC=CC=1 |
| CAS DataBase Reference | 76189-55-4(CAS DataBase Reference) |
Description and Uses
Useful ligand for transition metal catalyzed asymmetric reactions, including hydrogenation and disilylation. 2,2′-Bis(diphenylphosphino)-1,1′-binaphthyl and its rhodium and ruthenium derivatives are highly selective homogeneous catalysts used for the reduction of aryl ketones, β-keto esters, and α-amino ketones. They have also been used for asymmetric hydrogenation and hydroformylation of olefins, asymmetric Heck reactions, and asymmetric isomerizations of allyls.
Complex with Ag(I) used to catalyze an asymmetric aldol reaction between alkenyl trichloroacetates and aldehydes. Also used with Ag(I) to catalyze an enantioselective hetero-Diels-Alder reaction of azo compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| F | 8-10-23 |
| TSCA | No |
| HS Code | 29319090 |
