A1225912
N-(tert-Butoxycarbonyl)-L-leucine Monohydrate , 99% , 13139-15-6
CAS NO.：13139-15-6
Empirical Formula: C11H21NO4
Molecular Weight: 231.29
MDL number: MFCD00066067
EINECS: 236-073-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB55.20 | In Stock |
|
| 100G | RMB133.60 | In Stock |
|
| 250G | RMB399.20 | In Stock |
|
| 1kg | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87 °C |
| Boiling point: | 356.0±25.0 °C(Predicted) |
| Density | 1.061±0.06 g/cm3(Predicted) |
| refractive index | -25 ° (C=2, AcOH) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 4.02±0.21(Predicted) |
| form | Powder |
| color | White |
| optical activity | [α]20/D 25±0.5°, c = 2% in acetic acid |
| BRN | 1711814 |
| InChI | InChI=1S/C11H21NO4/c1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14)/t8-/m0/s1 |
| InChIKey | URQQEIOTRWJXBA-QRPNPIFTSA-N |
| SMILES | C(O)(=O)[C@H](CC(C)C)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 13139-15-6(CAS DataBase Reference) |
| EPA Substance Registry System | L-Leucine, N-[(1,1-dimethylethoxy)carbonyl]- (13139-15-6) |
Description and Uses
Protected amino acid with antimicrobial activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29241990 |
