A0791412
2-Amino-5-bromobenzonitrile , >98.0%(GC) , 39263-32-6
CAS NO.：39263-32-6
Empirical Formula: C7H5BrN2
Molecular Weight: 197.03
MDL number: MFCD00158946
EINECS: 254-387-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 250MG | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB91.20 | In Stock |
|
| 100G | RMB316.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-100 °C(lit.) |
| Boiling point: | 288.4±25.0 °C(Predicted) |
| Density | 1.6480 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in methanol. |
| form | Crystalline Powder |
| pka | 1.11±0.10(Predicted) |
| color | Off-white to pale brown |
| InChI | InChI=1S/C7H5BrN2/c8-6-1-2-7(10)5(3-6)4-9/h1-3H,10H2 |
| InChIKey | OATYCBHROMXWJO-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(Br)=CC=C1N |
Description and Uses
2-Amino-5-bromo-benzonitrile is a heterocyclic building block. It has been used in the synthesis of copper-ligand coordination complexes and 4-amino-3-benzimidazol-2-ylhydroquinolin-2-one-based multi-targeted receptor tyrosine kinase (RTK) inhibitors with anticancer activity.
2-Amino-5-bromobenzonitrile can react with Oxalic acid dimethyl ester to get 5-Bromo-N-methylanthranilonitrile.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H331-H335-H301-H315-H319-H302-H312-H317-H332 |
| Precautionary statements | P261-P304+P340-P305+P351+P338-P501a-P280-P264-P270-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-43-36/37/38 |
| Safety Statements | 36/37-36/37/39-26-22 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
