A0740612
5-Amino-2-hydroxypyridine , 97% , 33630-94-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB73.60 | In Stock |
|
| 5G | RMB292.80 | In Stock |
|
| 25G | RMB672.80 | In Stock |
|
| 100g | RMB2359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ca 180℃ |
| Boiling point: | 206.4°C (rough estimate) |
| Density | 1.208 |
| refractive index | 1.4800 (estimate) |
| storage temp. | Refrigerated. |
| form | powder |
| pka | 12.87±0.10(Predicted) |
| color | Black |
| InChI | InChI=1S/C5H6N2O/c6-4-1-2-5(8)7-3-4/h1-3H,6H2,(H,7,8) |
| InChIKey | GDOIKKMNCIMDAO-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(N)C=C1 |
Description and Uses
5-Amino-2-hydroxypyridine is mainly used as a raw material for organic synthesis and can be used in the preparation of pyrazole amides, electrode materials and dendritic polymers, among other products.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40-22-36 |
| Safety Statements | 22-26-36 |
| HS Code | 29333999 |
